C7H4F2N4O6 — CID 134935424
N,N-difluoro-3-methyl-2,4,6-trinitroaniline (PubChem CID 134935424) has the molecular formula C7H4F2N4O6 and a molecular weight of 278.13 g/mol. Its IUPAC name is N,N-difluoro-3-methyl-2,4,6-trinitroaniline.
| Compound Name | N,N-difluoro-3-methyl-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 134935424 |
| Molecular Formula | C7H4F2N4O6 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | N,N-difluoro-3-methyl-2,4,6-trinitroaniline |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(N(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4F2N4O6/c1-3-4(11(14)15)2-5(12(16)17)7(10(8)9)6(3)13(18)19/h2H,1H3 |
| InChIKey | CZKMJILJRTXKNJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|