C9H8N2O6 — CID 5224379
2,6-dimethyl-3,5-dinitrobenzoic acid (PubChem CID 5224379) has the molecular formula C9H8N2O6 and a molecular weight of 240.17 g/mol. Its IUPAC name is 2,6-dimethyl-3,5-dinitrobenzoic acid.
| Compound Name | 2,6-dimethyl-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 5224379 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2,6-dimethyl-3,5-dinitrobenzoic acid |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(C)c1C(=O)O |
| InChI | InChI=1S/C9H8N2O6/c1-4-6(10(14)15)3-7(11(16)17)5(2)8(4)9(12)13/h3H,1-2H3,(H,12,13) |
| InChIKey | JLANLQYZMDREKU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|