C8H5Cl2NO4 — CID 87869855
2,3-dichloro-4-methyl-6-nitrobenzoic acid (PubChem CID 87869855) has the molecular formula C8H5Cl2NO4 and a molecular weight of 250.04 g/mol. Its IUPAC name is 2,3-dichloro-4-methyl-6-nitrobenzoic acid.
| Compound Name | 2,3-dichloro-4-methyl-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 87869855 |
| Molecular Formula | C8H5Cl2NO4 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 2,3-dichloro-4-methyl-6-nitrobenzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl2NO4/c1-3-2-4(11(14)15)5(8(12)13)7(10)6(3)9/h2H,1H3,(H,12,13) |
| InChIKey | ORTATBJGQPMALX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|