C7H4F3N3O4 — CID 23223533
N,N,3-trifluoro-4-methyl-2,6-dinitroaniline (PubChem CID 23223533) has the molecular formula C7H4F3N3O4 and a molecular weight of 251.12 g/mol. Its IUPAC name is N,N,3-trifluoro-4-methyl-2,6-dinitroaniline.
| Compound Name | N,N,3-trifluoro-4-methyl-2,6-dinitroaniline |
|---|---|
| PubChem CID | 23223533 |
| Molecular Formula | C7H4F3N3O4 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N,N,3-trifluoro-4-methyl-2,6-dinitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])c(N(F)F)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C7H4F3N3O4/c1-3-2-4(12(14)15)6(11(9)10)7(5(3)8)13(16)17/h2H,1H3 |
| InChIKey | JUSNCQAUZZSGQF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|