C11H13F2NO3 — CID 125115915
2,4-difluoro-1-methyl-3-(2-methylpropoxy)-5-nitrobenzene (PubChem CID 125115915) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is 2,4-difluoro-1-methyl-3-(2-methylpropoxy)-5-nitrobenzene.
| Compound Name | 2,4-difluoro-1-methyl-3-(2-methylpropoxy)-5-nitrobenzene |
|---|---|
| PubChem CID | 125115915 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2,4-difluoro-1-methyl-3-(2-methylpropoxy)-5-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(F)c(OCC(C)C)c1F |
| InChI | InChI=1S/C11H13F2NO3/c1-6(2)5-17-11-9(12)7(3)4-8(10(11)13)14(15)16/h4,6H,5H2,1-3H3 |
| InChIKey | CNFAHYDRNWEZSS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|