C10H11Cl2NO3 — CID 10332995
1,2-dichloro-3-(2-methylpropoxy)-4-nitrobenzene (PubChem CID 10332995) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is 1,2-dichloro-3-(2-methylpropoxy)-4-nitrobenzene.
| Compound Name | 1,2-dichloro-3-(2-methylpropoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 10332995 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1,2-dichloro-3-(2-methylpropoxy)-4-nitrobenzene |
| SMILES | CC(C)COc1c([N+](=O)[O-])ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO3/c1-6(2)5-16-10-8(13(14)15)4-3-7(11)9(10)12/h3-4,6H,5H2,1-2H3 |
| InChIKey | CFQMTVPSSSBFTI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|