C10H11Cl3O — CID 91732249
1,2,4-trichloro-3-(2-methylpropoxy)benzene (PubChem CID 91732249) has the molecular formula C10H11Cl3O and a molecular weight of 253.56 g/mol. Its IUPAC name is 1,2,4-trichloro-3-(2-methylpropoxy)benzene.
| Compound Name | 1,2,4-trichloro-3-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 91732249 |
| Molecular Formula | C10H11Cl3O |
| Molecular Weight | 253.56 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1,2,4-trichloro-3-(2-methylpropoxy)benzene |
| SMILES | CC(C)COc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl3O/c1-6(2)5-14-10-8(12)4-3-7(11)9(10)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | IJTPTQWSKITYLT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|