C18H29O3Ti- — CID 87546026
titanium;1,2,3-tris(2-methylpropoxy)benzene-6-ide (PubChem CID 87546026) has the molecular formula C18H29O3Ti- and a molecular weight of 341.29 g/mol. Its IUPAC name is titanium;1,2,3-tris(2-methylpropoxy)benzene-6-ide.
| Compound Name | titanium;1,2,3-tris(2-methylpropoxy)benzene-6-ide |
|---|---|
| PubChem CID | 87546026 |
| Molecular Formula | C18H29O3Ti- |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | titanium;1,2,3-tris(2-methylpropoxy)benzene-6-ide |
| SMILES | CC(C)COc1[c-]ccc(OCC(C)C)c1OCC(C)C.[Ti] |
| InChI | InChI=1S/C18H29O3.Ti/c1-13(2)10-19-16-8-7-9-17(20-11-14(3)4)18(16)21-12-15(5)6;/h7-8,13-15H,10-12H2,1-6H3;/q-1; |
| InChIKey | NYXZPBBUQLVADZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|