C16H18N4O4S2 — CID 158325529
4-[[4-(dimethylamino)-2-nitrophenyl]disulfanyl]-N,N-dimethyl-3-nitroaniline (PubChem CID 158325529) has the molecular formula C16H18N4O4S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-2-nitrophenyl]disulfanyl]-N,N-dimethyl-3-nitroaniline.
| Compound Name | 4-[[4-(dimethylamino)-2-nitrophenyl]disulfanyl]-N,N-dimethyl-3-nitroaniline |
|---|---|
| PubChem CID | 158325529 |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-[[4-(dimethylamino)-2-nitrophenyl]disulfanyl]-N,N-dimethyl-3-nitroaniline |
| SMILES | CN(C)c1ccc(SSc2ccc(N(C)C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O4S2/c1-17(2)11-5-7-15(13(9-11)19(21)22)25-26-16-8-6-12(18(3)4)10-14(16)20(23)24/h5-10H,1-4H3 |
| InChIKey | GPIYTULHMJARGK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|