C13H19N3O5 — CID 110445111
3-(4,5-dimethoxy-2-nitrophenyl)-1,1-diethylurea (PubChem CID 110445111) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-nitrophenyl)-1,1-diethylurea.
| Compound Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 110445111 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-(4,5-dimethoxy-2-nitrophenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O5/c1-5-15(6-2)13(17)14-9-7-11(20-3)12(21-4)8-10(9)16(18)19/h7-8H,5-6H2,1-4H3,(H,14,17) |
| InChIKey | PKBKUBVUFWCESL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|