C19H31NO8 — CID 11079906
(2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-4,7-dimethoxy-2,6-dimethylheptane-1,3-diol (PubChem CID 11079906) has the molecular formula C19H31NO8 and a molecular weight of 401.46 g/mol. Its IUPAC name is (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-4,7-dimethoxy-2,6-dimethylheptane-1,3-diol.
| Compound Name | (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-4,7-dimethoxy-2,6-dimethylheptane-1,3-diol |
|---|---|
| PubChem CID | 11079906 |
| Molecular Formula | C19H31NO8 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (2R,3R,4S,6S,7R)-7-(2,5-dimethoxy-3-nitrophenyl)-4,7-dimethoxy-2,6-dimethylheptane-1,3-diol |
| SMILES | COc1cc([C@H](OC)[C@@H](C)C[C@H](OC)[C@H](O)[C@H](C)CO)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H31NO8/c1-11(7-16(26-4)17(22)12(2)10-21)18(27-5)14-8-13(25-3)9-15(20(23)24)19(14)28-6/h8-9,11-12,16-18,21-22H,7,10H2,1-6H3/t11-,12+,16-,17+,18+/m0/s1 |
| InChIKey | LRDWSUMUXHADEU-RWKYPWFPSA-N |
| XLogP | 2.33 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|