C17H27NO8 — CID 11740062
(2R,3R,5S,6R)-6-(2,5-dimethoxy-3-nitrophenyl)-2,6-dimethoxy-5-methylhexane-1,3-diol (PubChem CID 11740062) has the molecular formula C17H27NO8 and a molecular weight of 373.40 g/mol. Its IUPAC name is (2R,3R,5S,6R)-6-(2,5-dimethoxy-3-nitrophenyl)-2,6-dimethoxy-5-methylhexane-1,3-diol.
| Compound Name | (2R,3R,5S,6R)-6-(2,5-dimethoxy-3-nitrophenyl)-2,6-dimethoxy-5-methylhexane-1,3-diol |
|---|---|
| PubChem CID | 11740062 |
| Molecular Formula | C17H27NO8 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2R,3R,5S,6R)-6-(2,5-dimethoxy-3-nitrophenyl)-2,6-dimethoxy-5-methylhexane-1,3-diol |
| SMILES | COc1cc([C@H](OC)[C@@H](C)C[C@@H](O)[C@@H](CO)OC)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H27NO8/c1-10(6-14(20)15(9-19)24-3)16(25-4)12-7-11(23-2)8-13(18(21)22)17(12)26-5/h7-8,10,14-16,19-20H,6,9H2,1-5H3/t10-,14+,15+,16+/m0/s1 |
| InChIKey | URRAEYPMLIJUIP-ZWMNYZCKSA-N |
| XLogP | 1.69 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|