C23H32O6 — CID 10408939
(2R,3S,5S,6R)-6-(2,5-dimethoxyphenyl)-6-methoxy-5-methyl-2-phenylmethoxyhexane-1,3-diol (PubChem CID 10408939) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (2R,3S,5S,6R)-6-(2,5-dimethoxyphenyl)-6-methoxy-5-methyl-2-phenylmethoxyhexane-1,3-diol.
| Compound Name | (2R,3S,5S,6R)-6-(2,5-dimethoxyphenyl)-6-methoxy-5-methyl-2-phenylmethoxyhexane-1,3-diol |
|---|---|
| PubChem CID | 10408939 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (2R,3S,5S,6R)-6-(2,5-dimethoxyphenyl)-6-methoxy-5-methyl-2-phenylmethoxyhexane-1,3-diol |
| SMILES | COc1ccc(OC)c([C@H](OC)[C@@H](C)C[C@H](O)[C@@H](CO)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H32O6/c1-16(23(28-4)19-13-18(26-2)10-11-21(19)27-3)12-20(25)22(14-24)29-15-17-8-6-5-7-9-17/h5-11,13,16,20,22-25H,12,14-15H2,1-4H3/t16-,20-,22+,23+/m0/s1 |
| InChIKey | SSFQPMBUHCWAEU-ZOGZYCIHSA-N |
| XLogP | 3.36 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |