C17H25BNO7 — CID 135048660
CID 135048660 (PubChem CID 135048660) has the molecular formula C17H25BNO7 and a molecular weight of 366.20 g/mol.
| Compound Name | CID 135048660 |
|---|---|
| PubChem CID | 135048660 |
| Molecular Formula | C17H25BNO7 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | — |
| SMILES | COc1cc([C@H](OC)[C@@H](C)C[C@@H]2[B]OC[C@H]2OC)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25BNO7/c1-10(6-13-15(23-3)9-26-18-13)16(24-4)12-7-11(22-2)8-14(19(20)21)17(12)25-5/h7-8,10,13,15-16H,6,9H2,1-5H3/t10-,13-,15+,16+/m0/s1 |
| InChIKey | ATHKFBRJMNAAJI-SQWYCQTGSA-N |
| XLogP | 2.78 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|