C10H11NO6 — CID 129411470
[(2S)-7-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxin-2-yl]methanol (PubChem CID 129411470) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is [(2S)-7-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxin-2-yl]methanol.
| Compound Name | [(2S)-7-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxin-2-yl]methanol |
|---|---|
| PubChem CID | 129411470 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [(2S)-7-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxin-2-yl]methanol |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)OC[C@H](CO)O2 |
| InChI | InChI=1S/C10H11NO6/c1-15-6-2-8(11(13)14)10-9(3-6)17-7(4-12)5-16-10/h2-3,7,12H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | PKHYNZIQIWUUGU-ZETCQYMHSA-N |
| XLogP | 0.74 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|