C9H9NO5 — CID 174356582
(2R)-2-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxine (PubChem CID 174356582) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is (2R)-2-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (2R)-2-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 174356582 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (2R)-2-methoxy-5-nitro-2,3-dihydro-1,4-benzodioxine |
| SMILES | CO[C@H]1COc2c(cccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C9H9NO5/c1-13-8-5-14-9-6(10(11)12)3-2-4-7(9)15-8/h2-4,8H,5H2,1H3/t8-/m1/s1 |
| InChIKey | MSKZHULUXCQSDP-MRVPVSSYSA-N |
| XLogP | 1.34 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|