C9H9FO3 — CID 174359912
5-fluoro-2-methoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 174359912) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-fluoro-2-methoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 174359912 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-fluoro-2-methoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | COC1COc2c(F)cccc2O1 |
| InChI | InChI=1S/C9H9FO3/c1-11-8-5-12-9-6(10)3-2-4-7(9)13-8/h2-4,8H,5H2,1H3 |
| InChIKey | LDVNIWWSNRZQFA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |