C9H9BrO3 — CID 167513731
2-bromo-5-methoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 167513731) has the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. Its IUPAC name is 2-bromo-5-methoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 2-bromo-5-methoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 167513731 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 2-bromo-5-methoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | COc1cccc2c1OCC(Br)O2 |
| InChI | InChI=1S/C9H9BrO3/c1-11-6-3-2-4-7-9(6)12-5-8(10)13-7/h2-4,8H,5H2,1H3 |
| InChIKey | ATPOMCAMATTWLF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|