C23H32N2O4 — CID 67644254
N-[2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide (PubChem CID 67644254) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 67644254 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide |
| SMILES | COc1cccc2c1OCC(CNCCNC(=O)C13CC4CC(CC(C4)C1)C3)O2 |
| InChI | InChI=1S/C23H32N2O4/c1-27-19-3-2-4-20-21(19)28-14-18(29-20)13-24-5-6-25-22(26)23-10-15-7-16(11-23)9-17(8-15)12-23/h2-4,15-18,24H,5-14H2,1H3,(H,25,26) |
| InChIKey | CTSCHGYXHWZYBW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|