C22H32N2O4S — CID 108575099
N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]adamantane-1-carboxamide (PubChem CID 108575099) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 108575099 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]adamantane-1-carboxamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H32N2O4S/c1-14-6-19(28-3)20(7-15(14)2)29(26,27)24-5-4-23-21(25)22-11-16-8-17(12-22)10-18(9-16)13-22/h6-7,16-18,24H,4-5,8-13H2,1-3H3,(H,23,25) |
| InChIKey | MWJHJZIXZCMPCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|