C22H30N2O4S — CID 108573220
4-tert-butyl-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]benzamide (PubChem CID 108573220) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 108573220 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-tert-butyl-N-[2-[(2-methoxy-4,5-dimethylphenyl)sulfonylamino]ethyl]benzamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-15-13-19(28-6)20(14-16(15)2)29(26,27)24-12-11-23-21(25)17-7-9-18(10-8-17)22(3,4)5/h7-10,13-14,24H,11-12H2,1-6H3,(H,23,25) |
| InChIKey | FQFACCAFWMOJQS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|