C22H30N2O4 — CID 15293104
N-[2-[(5-hydroxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide (PubChem CID 15293104) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[2-[(5-hydroxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(5-hydroxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 15293104 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[2-[(5-hydroxy-2,3-dihydro-1,4-benzodioxin-2-yl)methylamino]ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCNCC1COc2c(O)cccc2O1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H30N2O4/c25-18-2-1-3-19-20(18)27-13-17(28-19)12-23-4-5-24-21(26)22-9-14-6-15(10-22)8-16(7-14)11-22/h1-3,14-17,23,25H,4-13H2,(H,24,26) |
| InChIKey | AMGXODXJGNNFJN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|