C23H33ClN2O3 — CID 67644109
N-[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide;hydrochloride (PubChem CID 67644109) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is N-[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide;hydrochloride.
| Compound Name | N-[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67644109 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide;hydrochloride |
| SMILES | Cc1cccc2c1OC(CNCCNC(=O)C13CC4CC(CC(C4)C1)C3)CO2.Cl |
| InChI | InChI=1S/C23H32N2O3.ClH/c1-15-3-2-4-20-21(15)28-19(14-27-20)13-24-5-6-25-22(26)23-10-16-7-17(11-23)9-18(8-16)12-23;/h2-4,16-19,24H,5-14H2,1H3,(H,25,26);1H |
| InChIKey | WKLJKAUILAXTBZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|