C26H38N2O3 — CID 67644987
N-[2-[[2-methyl-3-(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)propyl]amino]ethyl]adamantane-1-carboxamide (PubChem CID 67644987) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is N-[2-[[2-methyl-3-(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)propyl]amino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[[2-methyl-3-(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)propyl]amino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 67644987 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | N-[2-[[2-methyl-3-(5-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)propyl]amino]ethyl]adamantane-1-carboxamide |
| SMILES | Cc1cccc2c1OC(CC(C)CNCCNC(=O)C13CC4CC(CC(C4)C1)C3)CO2 |
| InChI | InChI=1S/C26H38N2O3/c1-17(8-22-16-30-23-5-3-4-18(2)24(23)31-22)15-27-6-7-28-25(29)26-12-19-9-20(13-26)11-21(10-19)14-26/h3-5,17,19-22,27H,6-16H2,1-2H3,(H,28,29) |
| InChIKey | SILZLNPILCUGKT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|