C24H32N2O4 — CID 67649744
N-[2-[(5-acetyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide (PubChem CID 67649744) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[2-[(5-acetyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(5-acetyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 67649744 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N-[2-[(5-acetyl-2,3-dihydro-1,4-benzodioxin-3-yl)methylamino]ethyl]adamantane-1-carboxamide |
| SMILES | CC(=O)c1cccc2c1OC(CNCCNC(=O)C13CC4CC(CC(C4)C1)C3)CO2 |
| InChI | InChI=1S/C24H32N2O4/c1-15(27)20-3-2-4-21-22(20)30-19(14-29-21)13-25-5-6-26-23(28)24-10-16-7-17(11-24)9-18(8-16)12-24/h2-4,16-19,25H,5-14H2,1H3,(H,26,28) |
| InChIKey | MTCGHRGSQRWDKO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|