C18H29NO2 — CID 129411882
(3S)-N,N-dibutyl-8-methoxy-3,4-dihydro-2H-chromen-3-amine (PubChem CID 129411882) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (3S)-N,N-dibutyl-8-methoxy-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3S)-N,N-dibutyl-8-methoxy-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 129411882 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (3S)-N,N-dibutyl-8-methoxy-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CCCCN(CCCC)[C@@H]1COc2c(cccc2OC)C1 |
| InChI | InChI=1S/C18H29NO2/c1-4-6-11-19(12-7-5-2)16-13-15-9-8-10-17(20-3)18(15)21-14-16/h8-10,16H,4-7,11-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | PRFNVLBAZHQQIZ-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |