C30H33F3N2O5S — CID 19592134
[3-[4-[(4-phenylbenzoyl)amino]butyl-propylamino]-3,4-dihydro-2H-chromen-8-yl] trifluoromethanesulfonate (PubChem CID 19592134) has the molecular formula C30H33F3N2O5S and a molecular weight of 590.66 g/mol. Its IUPAC name is [3-[4-[(4-phenylbenzoyl)amino]butyl-propylamino]-3,4-dihydro-2H-chromen-8-yl] trifluoromethanesulfonate.
| Compound Name | [3-[4-[(4-phenylbenzoyl)amino]butyl-propylamino]-3,4-dihydro-2H-chromen-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19592134 |
| Molecular Formula | C30H33F3N2O5S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | [3-[4-[(4-phenylbenzoyl)amino]butyl-propylamino]-3,4-dihydro-2H-chromen-8-yl] trifluoromethanesulfonate |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1COc2c(cccc2OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C30H33F3N2O5S/c1-2-18-35(26-20-25-11-8-12-27(28(25)39-21-26)40-41(37,38)30(31,32)33)19-7-6-17-34-29(36)24-15-13-23(14-16-24)22-9-4-3-5-10-22/h3-5,8-16,26H,2,6-7,17-21H2,1H3,(H,34,36) |
| InChIKey | FMYRIPJPXOXLHS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|