C30H37N3O2 — CID 19592098
N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide (PubChem CID 19592098) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide.
| Compound Name | N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 19592098 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N-[4-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2cccnc2)cc1)C1CCc2c(cccc2OC)C1 |
| InChI | InChI=1S/C30H37N3O2/c1-3-19-33(27-15-16-28-25(21-27)8-6-10-29(28)35-2)20-5-4-18-32-30(34)24-13-11-23(12-14-24)26-9-7-17-31-22-26/h6-14,17,22,27H,3-5,15-16,18-21H2,1-2H3,(H,32,34) |
| InChIKey | PDUGTZPNYSGRIM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|