C30H36N2O3S — CID 175230911
[(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-benzamidobutanoate (PubChem CID 175230911) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is [(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-benzamidobutanoate.
| Compound Name | [(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-benzamidobutanoate |
|---|---|
| PubChem CID | 175230911 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | [(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4-benzamidobutanoate |
| SMILES | CCCN(CCc1cccs1)[C@H]1CCc2c(cccc2OC(=O)CCCNC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C30H36N2O3S/c1-2-19-32(20-17-26-12-8-21-36-26)25-15-16-27-24(22-25)11-6-13-28(27)35-29(33)14-7-18-31-30(34)23-9-4-3-5-10-23/h3-6,8-13,21,25H,2,7,14-20,22H2,1H3,(H,31,34)/t25-/m0/s1 |
| InChIKey | LAOGXKAGILYHRS-VWLOTQADSA-N |
| XLogP | 5.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|