C33H51NO2S — CID 118668416
[6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4,6,7,8-tetramethyldecanoate (PubChem CID 118668416) has the molecular formula C33H51NO2S and a molecular weight of 525.84 g/mol. Its IUPAC name is [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4,6,7,8-tetramethyldecanoate.
| Compound Name | [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4,6,7,8-tetramethyldecanoate |
|---|---|
| PubChem CID | 118668416 |
| Molecular Formula | C33H51NO2S |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 4,6,7,8-tetramethyldecanoate |
| SMILES | CCCN(CCc1cccs1)C1CCc2c(cccc2OC(=O)CCC(C)CC(C)C(C)C(C)CC)C1 |
| InChI | InChI=1S/C33H51NO2S/c1-7-19-34(20-18-30-12-10-21-37-30)29-15-16-31-28(23-29)11-9-13-32(31)36-33(35)17-14-24(3)22-26(5)27(6)25(4)8-2/h9-13,21,24-27,29H,7-8,14-20,22-23H2,1-6H3 |
| InChIKey | IAWYZLSXXFDMOP-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|