C30H45NO2S — CID 118668125
[6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 3,4-diethylheptanoate (PubChem CID 118668125) has the molecular formula C30H45NO2S and a molecular weight of 483.76 g/mol. Its IUPAC name is [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 3,4-diethylheptanoate.
| Compound Name | [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 3,4-diethylheptanoate |
|---|---|
| PubChem CID | 118668125 |
| Molecular Formula | C30H45NO2S |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | [6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl] 3,4-diethylheptanoate |
| SMILES | CCCC(CC)C(CC)CC(=O)Oc1cccc2c1CCC(N(CCC)CCc1cccs1)C2 |
| InChI | InChI=1S/C30H45NO2S/c1-5-11-23(7-3)24(8-4)22-30(32)33-29-14-9-12-25-21-26(15-16-28(25)29)31(18-6-2)19-17-27-13-10-20-34-27/h9-10,12-14,20,23-24,26H,5-8,11,15-19,21-22H2,1-4H3 |
| InChIKey | GAXWYSYRARHBEE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|