C27H31N3O2 — CID 18396595
N-[4-[[(2R)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-pyridin-3-ylbenzamide (PubChem CID 18396595) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[4-[[(2R)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-pyridin-3-ylbenzamide.
| Compound Name | N-[4-[[(2R)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 18396595 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[4-[[(2R)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-pyridin-3-ylbenzamide |
| SMILES | CN(CCCCNC(=O)c1ccc(-c2cccnc2)cc1)[C@@H]1CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C27H31N3O2/c1-30(25-12-10-21-11-13-26(31)18-24(21)17-25)16-3-2-15-29-27(32)22-8-6-20(7-9-22)23-5-4-14-28-19-23/h4-9,11,13-14,18-19,25,31H,2-3,10,12,15-17H2,1H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | IAGBWPAVZPLOOR-RUZDIDTESA-N |
| XLogP | 4.45 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|