C35H56N2O2Sn — CID 18396648
N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-tributylstannylbenzamide (PubChem CID 18396648) has the molecular formula C35H56N2O2Sn and a molecular weight of 655.56 g/mol. Its IUPAC name is N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-tributylstannylbenzamide.
| Compound Name | N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-tributylstannylbenzamide |
|---|---|
| PubChem CID | 18396648 |
| Molecular Formula | C35H56N2O2Sn |
| Molecular Weight | 655.56 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]-4-tributylstannylbenzamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C(=O)NCCCCN(C)[C@@H]2CCc3ccc(OC)cc3C2)cc1 |
| InChI | InChI=1S/C23H29N2O2.3C4H9.Sn/c1-25(15-7-6-14-24-23(26)19-8-4-3-5-9-19)21-12-10-18-11-13-22(27-2)17-20(18)16-21;3*1-3-4-2;/h4-5,8-9,11,13,17,21H,6-7,10,12,14-16H2,1-2H3,(H,24,26);3*1,3-4H2,2H3;/t21-;;;;/m1..../s1 |
| InChIKey | UFVWTERFVLKLII-YRTCJPGSSA-N |
| XLogP | 7.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.56 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|