C23H29BrN2O2 — CID 18396647
4-bromo-N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]benzamide (PubChem CID 18396647) has the molecular formula C23H29BrN2O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 4-bromo-N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]benzamide.
| Compound Name | 4-bromo-N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]benzamide |
|---|---|
| PubChem CID | 18396647 |
| Molecular Formula | C23H29BrN2O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-bromo-N-[4-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]butyl]benzamide |
| SMILES | COc1ccc2c(c1)C[C@H](N(C)CCCCNC(=O)c1ccc(Br)cc1)CC2 |
| InChI | InChI=1S/C23H29BrN2O2/c1-26(21-11-7-17-8-12-22(28-2)16-19(17)15-21)14-4-3-13-25-23(27)18-5-9-20(24)10-6-18/h5-6,8-10,12,16,21H,3-4,7,11,13-15H2,1-2H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | QGYPYRQWQVIVRA-OAQYLSRUSA-N |
| XLogP | 4.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|