C25H34ClNO5 — CID 12843127
4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]butyl 3,4-dimethoxybenzoate;hydrochloride (PubChem CID 12843127) has the molecular formula C25H34ClNO5 and a molecular weight of 464.00 g/mol. Its IUPAC name is 4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]butyl 3,4-dimethoxybenzoate;hydrochloride.
| Compound Name | 4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]butyl 3,4-dimethoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 12843127 |
| Molecular Formula | C25H34ClNO5 |
| Molecular Weight | 464.00 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]butyl 3,4-dimethoxybenzoate;hydrochloride |
| SMILES | COc1ccc2c(c1)CCC(N(C)CCCCOC(=O)c1ccc(OC)c(OC)c1)C2.Cl |
| InChI | InChI=1S/C25H33NO5.ClH/c1-26(21-10-7-19-16-22(28-2)11-8-18(19)15-21)13-5-6-14-31-25(27)20-9-12-23(29-3)24(17-20)30-4;/h8-9,11-12,16-17,21H,5-7,10,13-15H2,1-4H3;1H |
| InChIKey | UZFIPYZHEMCHDA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.00 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|