C12H20ClNO5 — CID 175234881
2-(methylamino)ethyl 3,4-dimethoxybenzoate;hydrate;hydrochloride (PubChem CID 175234881) has the molecular formula C12H20ClNO5 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-(methylamino)ethyl 3,4-dimethoxybenzoate;hydrate;hydrochloride.
| Compound Name | 2-(methylamino)ethyl 3,4-dimethoxybenzoate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 175234881 |
| Molecular Formula | C12H20ClNO5 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-(methylamino)ethyl 3,4-dimethoxybenzoate;hydrate;hydrochloride |
| SMILES | CNCCOC(=O)c1ccc(OC)c(OC)c1.Cl.O |
| InChI | InChI=1S/C12H17NO4.ClH.H2O/c1-13-6-7-17-12(14)9-4-5-10(15-2)11(8-9)16-3;;/h4-5,8,13H,6-7H2,1-3H3;1H;1H2 |
| InChIKey | XUTIBNMCTMNUPU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|