C16H22O5 — CID 174261054
4-prop-2-enoxybutyl 3,4-dimethoxybenzoate (PubChem CID 174261054) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-prop-2-enoxybutyl 3,4-dimethoxybenzoate.
| Compound Name | 4-prop-2-enoxybutyl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 174261054 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-prop-2-enoxybutyl 3,4-dimethoxybenzoate |
| SMILES | C=CCOCCCCOC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H22O5/c1-4-9-20-10-5-6-11-21-16(17)13-7-8-14(18-2)15(12-13)19-3/h4,7-8,12H,1,5-6,9-11H2,2-3H3 |
| InChIKey | IMGYDVRXDVYXGD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|