C27H37NO6 — CID 3053323
4-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-ethylamino]butyl 3,4-dimethoxybenzoate (PubChem CID 3053323) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-ethylamino]butyl 3,4-dimethoxybenzoate.
| Compound Name | 4-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-ethylamino]butyl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3053323 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-ethylamino]butyl 3,4-dimethoxybenzoate |
| SMILES | CCN(CCCCOC(=O)c1ccc(OC)c(OC)c1)C1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C27H37NO6/c1-6-28(22-11-9-19-16-25(32-4)26(33-5)18-21(19)15-22)13-7-8-14-34-27(29)20-10-12-23(30-2)24(17-20)31-3/h10,12,16-18,22H,6-9,11,13-15H2,1-5H3 |
| InChIKey | XZEJLMPKKLKAGH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|