About 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate
4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate (PubChem CID 15788451) has the molecular formula C19H29NO6
and a molecular weight of 367.44 g/mol. Its IUPAC name is 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate.
Molecular Properties
| Compound Name | 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate |
| PubChem CID | 15788451 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)OCCCCN(CC)CC)cc1OC |
| InChI | InChI=1S/C19H29NO6/c1-5-20(6-2)12-8-9-13-25-18(21)15-10-11-16(17(14-15)23-4)26-19(22)24-7-3/h10-11,14H,5-9,12-13H2,1-4H3 |
| InChIKey | KPXPKYSGQBHMQE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate?
The IUPAC name of 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate (CID 15788451) is 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate.
What is the SMILES notation for 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate?
The canonical SMILES for 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate is CCOC(=O)Oc1ccc(C(=O)OCCCCN(CC)CC)cc1OC.
What is the InChIKey of 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate?
The InChIKey is KPXPKYSGQBHMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO6/c1-5-20(6-2)12-8-9-13-25-18(21)15-10-11-16(17(14-15)23-4)26-19(22)24-7-3/h10-11,14H,5-9,12-13H2,1-4H3.
What are the key properties of 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate?
4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate has a molecular weight of 367.44 g/mol, XLogP of 3.51, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)butyl 4-ethoxycarbonyloxy-3-methoxybenzoate is sourced from PubChem (CID 15788451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).