About 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride
3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride (PubChem CID 53347168) has the molecular formula C16H23ClNO6-
and a molecular weight of 360.81 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride |
| PubChem CID | 53347168 |
| Molecular Formula | C16H23ClNO6- |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride |
| SMILES | CCOC(=O)Oc1ccc(C(=O)OCCCN(C)C)cc1OC.[Cl-] |
| InChI | InChI=1S/C16H23NO6.ClH/c1-5-21-16(19)23-13-8-7-12(11-14(13)20-4)15(18)22-10-6-9-17(2)3;/h7-8,11H,5-6,9-10H2,1-4H3;1H/p-1 |
| InChIKey | NWROUXRBNKBZRD-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride?
The IUPAC name of 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride (CID 53347168) is 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride.
What is the SMILES notation for 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride?
The canonical SMILES for 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride is CCOC(=O)Oc1ccc(C(=O)OCCCN(C)C)cc1OC.[Cl-].
What is the InChIKey of 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride?
The InChIKey is NWROUXRBNKBZRD-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H23NO6.ClH/c1-5-21-16(19)23-13-8-7-12(11-14(13)20-4)15(18)22-10-6-9-17(2)3;/h7-8,11H,5-6,9-10H2,1-4H3;1H/p-1.
What are the key properties of 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride?
3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride has a molecular weight of 360.81 g/mol, XLogP of -0.66, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 4-ethoxycarbonyloxy-3-methoxybenzoate chloride is sourced from PubChem (CID 53347168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).