C26H35NO5 — CID 12843156
4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 2,6-dimethoxybenzoate (PubChem CID 12843156) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 2,6-dimethoxybenzoate.
| Compound Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 12843156 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 2,6-dimethoxybenzoate |
| SMILES | CCN(CCCCOC(=O)c1c(OC)cccc1OC)C1CCc2cc(OC)ccc2C1 |
| InChI | InChI=1S/C26H35NO5/c1-5-27(21-13-11-20-18-22(29-2)14-12-19(20)17-21)15-6-7-16-32-26(28)25-23(30-3)9-8-10-24(25)31-4/h8-10,12,14,18,21H,5-7,11,13,15-17H2,1-4H3 |
| InChIKey | OTVUKCWIAGWBJN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|