C21H33N3O2 — CID 22640269
4-[4-[ethyl-(5-methoxy-2,3-dihydro-1H-inden-2-yl)amino]butyl]-1,4-diazepan-5-one (PubChem CID 22640269) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-[4-[ethyl-(5-methoxy-2,3-dihydro-1H-inden-2-yl)amino]butyl]-1,4-diazepan-5-one.
| Compound Name | 4-[4-[ethyl-(5-methoxy-2,3-dihydro-1H-inden-2-yl)amino]butyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 22640269 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-[4-[ethyl-(5-methoxy-2,3-dihydro-1H-inden-2-yl)amino]butyl]-1,4-diazepan-5-one |
| SMILES | CCN(CCCCN1CCNCCC1=O)C1Cc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C21H33N3O2/c1-3-23(11-4-5-12-24-13-10-22-9-8-21(24)25)19-14-17-6-7-20(26-2)16-18(17)15-19/h6-7,16,19,22H,3-5,8-15H2,1-2H3 |
| InChIKey | YVTKCJFHTYKLJB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|