C19H28F2N2O — CID 110445656
N-[5-[cyclohexyl(methyl)amino]pentyl]-3,4-difluorobenzamide (PubChem CID 110445656) has the molecular formula C19H28F2N2O and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[5-[cyclohexyl(methyl)amino]pentyl]-3,4-difluorobenzamide.
| Compound Name | N-[5-[cyclohexyl(methyl)amino]pentyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110445656 |
| Molecular Formula | C19H28F2N2O |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[5-[cyclohexyl(methyl)amino]pentyl]-3,4-difluorobenzamide |
| SMILES | CN(CCCCCNC(=O)c1ccc(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H28F2N2O/c1-23(16-8-4-2-5-9-16)13-7-3-6-12-22-19(24)15-10-11-17(20)18(21)14-15/h10-11,14,16H,2-9,12-13H2,1H3,(H,22,24) |
| InChIKey | MWNCJWONGWHMBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|