C16H22F2N2O3S — CID 113065838
N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]-3,4-difluorobenzamide (PubChem CID 113065838) has the molecular formula C16H22F2N2O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113065838 |
| Molecular Formula | C16H22F2N2O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[2-[cyclohexyl(methylsulfonyl)amino]ethyl]-3,4-difluorobenzamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)c1ccc(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H22F2N2O3S/c1-24(22,23)20(13-5-3-2-4-6-13)10-9-19-16(21)12-7-8-14(17)15(18)11-12/h7-8,11,13H,2-6,9-10H2,1H3,(H,19,21) |
| InChIKey | KDWVYKJNXGJCGM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |