C35H52ClF3N2O4S — CID 158289356
1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanone;[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] trifluoromethanesulfonate;hydrochloride (PubChem CID 158289356) has the molecular formula C35H52ClF3N2O4S and a molecular weight of 689.33 g/mol. Its IUPAC name is 1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanone;[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] trifluoromethanesulfonate;hydrochloride.
| Compound Name | 1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanone;[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] trifluoromethanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 158289356 |
| Molecular Formula | C35H52ClF3N2O4S |
| Molecular Weight | 689.33 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | 1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanone;[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] trifluoromethanesulfonate;hydrochloride |
| SMILES | CCCN(CCC)C1CCc2cccc(C(C)=O)c2C1.CCCN(CCC)C1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2C1.Cl |
| InChI | InChI=1S/C18H27NO.C17H24F3NO3S.ClH/c1-4-11-19(12-5-2)16-10-9-15-7-6-8-17(14(3)20)18(15)13-16;1-3-10-21(11-4-2)14-9-8-13-6-5-7-16(15(13)12-14)24-25(22,23)17(18,19)20;/h6-8,16H,4-5,9-13H2,1-3H3;5-7,14H,3-4,8-12H2,1-2H3;1H |
| InChIKey | HYORZFKZUMOEQV-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.33 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|