C20H32N2O — CID 139908769
(NE)-N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butylidene]hydroxylamine (PubChem CID 139908769) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is (NE)-N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butylidene]hydroxylamine |
|---|---|
| PubChem CID | 139908769 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | (NE)-N-[1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butylidene]hydroxylamine |
| SMILES | CCC/C(=N\O)c1cccc2c1CC(N(CCC)CCC)CC2 |
| InChI | InChI=1S/C20H32N2O/c1-4-8-20(21-23)18-10-7-9-16-11-12-17(15-19(16)18)22(13-5-2)14-6-3/h7,9-10,17,23H,4-6,8,11-15H2,1-3H3/b21-20+ |
| InChIKey | PVGZREAZLCIQFP-QZQOTICOSA-N |
| XLogP | 4.64 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|