C19H26N4 — CID 23373523
N,N-dipropyl-8-(1,3,5-triazin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 23373523) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is N,N-dipropyl-8-(1,3,5-triazin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N,N-dipropyl-8-(1,3,5-triazin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 23373523 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N,N-dipropyl-8-(1,3,5-triazin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2cccc(-c3ncncn3)c2C1 |
| InChI | InChI=1S/C19H26N4/c1-3-10-23(11-4-2)16-9-8-15-6-5-7-17(18(15)12-16)19-21-13-20-14-22-19/h5-7,13-14,16H,3-4,8-12H2,1-2H3 |
| InChIKey | JRADAKSTIZEHKN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |