C22H35NO — CID 10404331
8-(1-butoxyethenyl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10404331) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is 8-(1-butoxyethenyl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-(1-butoxyethenyl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10404331 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 8-(1-butoxyethenyl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=C(OCCCC)c1cccc2c1CC(N(CCC)CCC)CC2 |
| InChI | InChI=1S/C22H35NO/c1-5-8-16-24-18(4)21-11-9-10-19-12-13-20(17-22(19)21)23(14-6-2)15-7-3/h9-11,20H,4-8,12-17H2,1-3H3 |
| InChIKey | LCCLHVXVOYZSJL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|