C24H39NO2 — CID 118668200
[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] octanoate (PubChem CID 118668200) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is [7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] octanoate.
| Compound Name | [7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] octanoate |
|---|---|
| PubChem CID | 118668200 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | [7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cccc2c1CC(N(CCC)CCC)CC2 |
| InChI | InChI=1S/C24H39NO2/c1-4-7-8-9-10-14-24(26)27-23-13-11-12-20-15-16-21(19-22(20)23)25(17-5-2)18-6-3/h11-13,21H,4-10,14-19H2,1-3H3 |
| InChIKey | KBMLKMGYGFFLHN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|