C16H21F4NO4S — CID 22853674
[(3R)-3-(dipropylamino)-8-fluoro-3,4-dihydro-2H-chromen-5-yl] trifluoromethanesulfonate (PubChem CID 22853674) has the molecular formula C16H21F4NO4S and a molecular weight of 399.41 g/mol. Its IUPAC name is [(3R)-3-(dipropylamino)-8-fluoro-3,4-dihydro-2H-chromen-5-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-3-(dipropylamino)-8-fluoro-3,4-dihydro-2H-chromen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22853674 |
| Molecular Formula | C16H21F4NO4S |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(3R)-3-(dipropylamino)-8-fluoro-3,4-dihydro-2H-chromen-5-yl] trifluoromethanesulfonate |
| SMILES | CCCN(CCC)[C@H]1COc2c(F)ccc(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C16H21F4NO4S/c1-3-7-21(8-4-2)11-9-12-14(25-26(22,23)16(18,19)20)6-5-13(17)15(12)24-10-11/h5-6,11H,3-4,7-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | NNAUOGXUKKXVEG-LLVKDONJSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|